For research use only. Not for therapeutic Use.
6-Chloro-8-quinolinecarboxylic Acid(CAT: R013135) is a chemical compound with applications in pharmaceutical and organic chemistry. This compound serves as a valuable intermediate in the synthesis of quinoline-based molecules, which are known for their diverse pharmacological properties. In pharmaceutical research, it plays a crucial role in the development of potential drug candidates, particularly those with anti-infective and antimalarial activities.
CAS Number | 6456-78-6 |
Synonyms | 6-Chloroquinoline-8-carboxylic Acid; |
Molecular Formula | C10H6ClNO2 |
Purity | ≥95% |
Storage | Desiccate at +4C |
IUPAC Name | 6-chloroquinoline-8-carboxylic acid |
InChI | InChI=1S/C10H6ClNO2/c11-7-4-6-2-1-3-12-9(6)8(5-7)10(13)14/h1-5H,(H,13,14) |
InChIKey | GGHKFVNCVUIGRP-UHFFFAOYSA-N |
SMILES | C1=CC2=CC(=CC(=C2N=C1)C(=O)O)Cl |