For research use only. Not for therapeutic Use.
6-Chloro-N-methyl-2-pyridinecarboxamide (Cat. No: R026091) is a polycyclic compound that can be used as a pharmaceutical chemical intermediate for drug preparation in the fine chemical industry, mainly as a standard reference for scientific research.
| Catalog Number | R026091 |
| CAS Number | 845306-04-9 |
| Synonyms | 6-Chloro-N-methylpicolinamide |
| Molecular Formula | C7H7ClN2O |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | 6-chloro-N-methylpyridine-2-carboxamide |
| InChI | InChI=1S/C7H7ClN2O/c1-9-7(11)5-3-2-4-6(8)10-5/h2-4H,1H3,(H,9,11) |
| InChIKey | PZDCYXWZXSTONB-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=NC(=CC=C1)Cl |
