For research use only. Not for therapeutic Use.
(6-Chloroimidazo[1,2-b]pyridazin-3-yl)(phenyl)methanone(CAT: L021335) is a high-purity heterocyclic compound widely utilized in pharmaceutical and chemical research. This molecule features a 6-chloroimidazo[1,2-b]pyridazine core linked to a phenylmethanone group, offering a unique combination of structural and electronic properties. It serves as a valuable intermediate in the synthesis of bioactive molecules, particularly in the development of therapeutic agents targeting enzyme or receptor systems. (6-Chloroimidazo[1,2-b]pyridazin-3-yl)(phenyl)methanone supports innovative applications in medicinal chemistry, fine chemical production, and advanced materials research, ensuring consistent performance and reliable experimental outcomes.
CAS Number | 90734-72-8 |
Molecular Formula | C13H8ClN3O |
Purity | ≥95% |
IUPAC Name | (6-chloroimidazo[1,2-b]pyridazin-3-yl)-phenylmethanone |
InChI | InChI=1S/C13H8ClN3O/c14-11-6-7-12-15-8-10(17(12)16-11)13(18)9-4-2-1-3-5-9/h1-8H |
InChIKey | DWEXNPGMMTWOKC-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C(=O)C2=CN=C3N2N=C(C=C3)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |