For research use only. Not for therapeutic Use.
6,7-Difluoro-2-tetralone(Cat No.:L007113), is a chemical compound. It belongs to the class of aromatic ketones and is characterized by a tetralone structure, a bicyclic ring system composed of a ketone functional group, and two adjacent fused benzene rings, with fluorine atoms attached at the 6th and 7th positions. This compound serves as a valuable intermediate in organic synthesis, often employed in the creation of more complex molecules for pharmaceutical and agrochemical research. Its unique structure makes it a versatile building block, enabling the development of diverse chemical compounds with potential applications in various scientific fields.
CAS Number | 40484-36-4 |
Molecular Formula | C14H10ClN |
Purity | ≥95% |
IUPAC Name | 6-(chloromethyl)phenanthridine |
InChI | InChI=1S/C14H10ClN/c15-9-14-12-7-2-1-5-10(12)11-6-3-4-8-13(11)16-14/h1-8H,9H2 |
InChIKey | LIFHMKCDDVTICL-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3N=C2CCl |