For research use only. Not for therapeutic Use.
6-Chloropurine-13C2,15N is a doubly labeled isotopic compound, where two carbon atoms are replaced with the carbon-13 isotope and one nitrogen atom is replaced with the nitrogen-15 isotope. This labeling is particularly useful in biochemical and pharmacokinetic studies, allowing for precise tracking and analysis in mass spectrometry and NMR spectroscopy. 6-Chloropurine is a purine derivative, often used in research related to nucleic acids and their metabolism. The isotopic labels do not alter the compound’s chemical properties but provide a powerful tool for studying complex biological processes.
| Catalog Number | R013920 |
| CAS Number | 1246816-87-4 |
| Synonyms | 6-Chloro-9H-purine-13C2,15N; NSC 744-13C2,15N; |
| Molecular Formula | C5H3ClN4 |
| Purity | ≥95% |
| Storage | -80°C |
| IUPAC Name | 6-chloro-7H-purine |
| InChI | InChI=1S/C5H3ClN4/c6-4-3-5(9-1-7-3)10-2-8-4/h1-2H,(H,7,8,9,10)/i1+1,5+1,7+1 |
| InChIKey | ZKBQDFAWXLTYKS-RIFLFRLYSA-N |
| SMILES | C1=NC2=C(N1)C(=NC=N2)Cl |
