For research use only. Not for therapeutic Use.
6-Chloropurine 2’-deoxy-β-D-ribofuranoside is a nucleoside analogue composed of a chlorinated purine base attached to a deoxyribose sugar. This compound is of significant interest in medicinal chemistry, particularly in antiviral and anticancer research, due to its potential to interfere with DNA and RNA synthesis. As a purine derivative, it can be incorporated into nucleic acid chains, disrupting normal cellular replication processes. Researchers explore its applications in the development of chemotherapeutic agents and other nucleoside-based therapeutics.
CAS Number | 4594-45-0 |
Synonyms | 6-Chloropurine Deoxyriboside; NSC 409824; 6-Chloro-9-(2-deoxy-β-D-erythro-pentofuranosyl)-9H-purine; (2R,3S,5R)-5-(6-Chloro-9H-purin-9-yl)-2-(hydroxymethyl)tetrahydrofuran-3-ol |
Molecular Formula | C₁₀H₁₁ClN₄O₃ |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 5-(6-chloropurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
InChI | 1S/C10H11ClN4O3/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(17)6(2-16)18-7/h3-7,16-17H,1-2H2 |
InChIKey | PGEULCIODBNODW-UHFFFAOYSA-N |
SMILES | C1C(C(OC1N2C=NC3=C2N=CN=C3Cl)CO)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |