For research use only. Not for therapeutic Use.
6-Chloropyridin-3-ol (Cat.No:M247964) is a chemical compound with applications in various industries, including pharmaceuticals and agrochemicals. Its chlorinated pyridine structure makes it useful as a building block in organic synthesis. It serves as a versatile intermediate for creating diverse molecules with potential pharmaceutical and chemical properties.
| Catalog Number | M247964 |
| CAS Number | 41288-96-4 |
| Molecular Formula | C5H4ClNO |
| Purity | ≥95% |
| IUPAC Name | 6-chloropyridin-3-ol |
| InChI | InChI=1S/C5H4ClNO/c6-5-2-1-4(8)3-7-5/h1-3,8H |
| InChIKey | KVCOOWROABTXDJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1O)Cl |
