For research use only. Not for therapeutic Use.
(6-Chloropyridin-3-yl)methanesulfonyl chloride(Cat No.:L007623) is a chemical compound characterized by a chloropyridinyl group attached to a methanesulfonyl chloride moiety. This specific molecular structure is important in organic synthesis and medicinal chemistry. Researchers use it as a versatile reagent in the creation of complex organic molecules, particularly in the development of pharmaceuticals and agrochemicals. Its reactivity allows for diverse chemical transformations, making it instrumental in the synthesis of fine chemicals.
CAS Number | 683813-60-7 |
Molecular Formula | C6H5Cl2NO2S |
Purity | ≥95% |
IUPAC Name | (6-chloropyridin-3-yl)methanesulfonyl chloride |
InChI | InChI=1S/C6H5Cl2NO2S/c7-6-2-1-5(3-9-6)4-12(8,10)11/h1-3H,4H2 |
InChIKey | PHGINWFLGGHDGG-UHFFFAOYSA-N |
SMILES | C1=CC(=NC=C1CS(=O)(=O)Cl)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |