For research use only. Not for therapeutic Use.
6-Cyano-2-naphthol (CAT: R001373) is a chemical compound with diverse applications in various fields. Its molecular structure, which combines a naphthol moiety with a cyano group, contributes to its unique properties and reactivity. This compound finds use in organic synthesis, serving as a key building block for creating more complex molecules. Additionally, it holds potential in dye and pigment manufacturing due to its chromophoric nature. Its applications extend to materials science and pharmaceutical research, where its structure can be modified to design molecules with specific properties or biological activities.
CAS Number | 52927-22-7 |
Synonyms | 6-Hydroxy-2-naphthalenecarbonitrile; 2-Cyano-6-hydroxynaphthalene; 2-Hydroxy-6-naphthonitrile; |
Molecular Formula | C11H7NO |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 6-hydroxynaphthalene-2-carbonitrile |
InChI | InChI=1S/C11H7NO/c12-7-8-1-2-10-6-11(13)4-3-9(10)5-8/h1-6,13H |
InChIKey | WKTNIBWKHNIPQR-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=CC(=C2)O)C=C1C#N |