For research use only. Not for therapeutic Use.
6-(Dimethylamino)-1-benzofuran-2-carboxylic acid (Cat.No:L003413) is a notable chemical compound with diverse applications in pharmaceutical research. Its distinct benzofuran structure, coupled with a dimethylamino group, makes it a valuable scaffold for the synthesis of bioactive molecules. This compound’s versatility and potential in drug development underscore its significance in the quest for innovative pharmaceutical agents.
CAS Number | 842958-64-9 |
Molecular Formula | C11H11NO3 |
Purity | ≥95% |
IUPAC Name | 6-(dimethylamino)-1-benzofuran-2-carboxylic acid |
InChI | InChI=1S/C11H11NO3/c1-12(2)8-4-3-7-5-10(11(13)14)15-9(7)6-8/h3-6H,1-2H3,(H,13,14) |
InChIKey | PXDNQIZFKMJABT-UHFFFAOYSA-N |
SMILES | CN(C)C1=CC2=C(C=C1)C=C(O2)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |