For research use only. Not for therapeutic Use.
6-Dimethylaminopurine(Cat No.:R000805) is a synthetic compound belonging to the class of purine derivatives. Its mode of action and pharmacological effects involve interactions with cellular processes and molecular targets due to its specific chemical structure. 6-Dimethylaminopurine is often used as a cell-permeable analog of adenine and has been investigated for its potential bioactivities, including as a cyclin-dependent kinase inhibitor and a potential agent for cell cycle arrest. Its applications extend to cellular and molecular research, particularly in studies involving cell division, proliferation, and signaling pathways.
CAS Number | 938-55-6 |
Synonyms | N6,N6-Dimethyladenine; N,N-Dimethyl-1H-purin-6-amine; N,N-Dimethyl-adenine; 6-(Dimethylamino)purine; 6-DMAP; DMAP; NSC 401568; |
Molecular Formula | C7H9N5 |
Purity | ≥95% |
Target | CDK |
Storage | -20°C |
IUPAC Name | N,N-dimethyl-7H-purin-6-amine |
InChI | InChI=1S/C7H9N5/c1-12(2)7-5-6(9-3-8-5)10-4-11-7/h3-4H,1-2H3,(H,8,9,10,11) |
InChIKey | BVIAOQMSVZHOJM-UHFFFAOYSA-N |
SMILES | CN(C)C1=NC=NC2=C1NC=N2 |