For research use only. Not for therapeutic Use.
6-((Ethylamino)methyl) pyridine-2 (1H)-one(Cat No.:L007345), is a significant chemical compound with versatile applications. Its structure, featuring an ethylamino group and a pyridinone core, lends itself to various chemical processes. Researchers employ it as a valuable intermediate in the synthesis of complex organic molecules, especially in the field of medicinal chemistry. Its reactivity and unique structure make it useful in the development of pharmaceuticals and specialty chemicals. Chemists leverage its properties for the design and synthesis of compounds crucial for biological studies and drug discovery efforts.
CAS Number | 1692781-26-2 |
Molecular Formula | C8H12N2O |
Purity | ≥95% |
IUPAC Name | 6-(ethylaminomethyl)-1H-pyridin-2-one |
InChI | InChI=1S/C8H12N2O/c1-2-9-6-7-4-3-5-8(11)10-7/h3-5,9H,2,6H2,1H3,(H,10,11) |
InChIKey | SDNIEIXWTOHGRD-UHFFFAOYSA-N |
SMILES | CCNCC1=CC=CC(=O)N1 |