For research use only. Not for therapeutic Use.
6-Ethynylisoquinoline(CAT: L035154) is a high-purity heterocyclic compound featuring an isoquinoline core with an ethynyl group at the 6-position. This versatile molecule serves as a critical building block in pharmaceutical research and organic synthesis, particularly for the development of bioactive compounds, functional materials, and complex heterocyclic frameworks. The ethynyl group provides a reactive site for cross-coupling reactions (e.g., Sonogashira coupling) and other targeted transformations, making it valuable for constructing conjugated systems and advanced materials. 6-Ethynylisoquinoline is ideal for precision-driven applications in medicinal chemistry, material science, and innovative chemical synthesis.
| CAS Number | 1015070-57-1 |
| Molecular Formula | C11H7N |
| Purity | ≥95% |
| IUPAC Name | 6-ethynylisoquinoline |
| InChI | InChI=1S/C11H7N/c1-2-9-3-4-11-8-12-6-5-10(11)7-9/h1,3-8H |
| InChIKey | ULAVHAJIBKHAPF-UHFFFAOYSA-N |
| SMILES | C#CC1=CC2=C(C=C1)C=NC=C2 |
