For research use only. Not for therapeutic Use.
6-Ethynylpyridin-3-amine is an organic compound with the chemical formula C9H7N. It consists of a pyridine ring (a six-membered aromatic ring with one nitrogen atom) substituted at the 3-position by an amine group (-NH2) and at the 6-position by an ethynyl group (-C≡C). This compound is of interest in organic synthesis and medicinal chemistry, often acting as a building block for more complex molecules. It may also exhibit potential bioactivity depending on the context of use.
| Catalog Number | L016243 |
| CAS Number | 1256824-94-8 |
| Molecular Formula | C7H6N2 |
| Purity | ≥95% |
| IUPAC Name | 6-ethynylpyridin-3-amine |
| InChI | InChI=1S/C7H6N2/c1-2-7-4-3-6(8)5-9-7/h1,3-5H,8H2 |
| InChIKey | FXZKQERWTFBNJI-UHFFFAOYSA-N |
| SMILES | C#CC1=NC=C(C=C1)N |
