For research use only. Not for therapeutic Use.
6-Fluoro-1-benzofuran-3-carboxylic acid(CAT: L010536) is a fluorinated benzofuran derivative with applications in organic and medicinal chemistry. The presence of a carboxylic acid group on the benzofuran ring allows for functional versatility, making it a valuable intermediate in the synthesis of bioactive molecules. The fluorine substituent enhances the compound’s metabolic stability and can influence binding affinity in drug-target interactions, which is advantageous in pharmaceutical research. This compound is frequently explored in the design of novel therapeutic agents, particularly in studies focused on anti-inflammatory, antimicrobial, and anticancer properties, due to its unique structural and electronic properties.
Catalog Number | L010536 |
CAS Number | 1393561-25-5 |
Molecular Formula | C9H5FO3 |
Purity | ≥95% |
IUPAC Name | 6-fluoro-1-benzofuran-3-carboxylic acid |
InChI | InChI=1S/C9H5FO3/c10-5-1-2-6-7(9(11)12)4-13-8(6)3-5/h1-4H,(H,11,12) |
InChIKey | ATVWVNCCIAXRMZ-UHFFFAOYSA-N |