For research use only. Not for therapeutic Use.
6-Fluoro-1,2,3,4-tetrahydro-2-methylquinoline is a fluorinated quinoline derivative used in pharmaceutical and chemical research. It serves as a building block for the synthesis of various biologically active compounds, including potential therapeutic agents. This compound is essential for studying reaction mechanisms, developing synthetic methodologies, and exploring the pharmacological properties of quinoline derivatives. Researchers rely on 6-Fluoro-1,2,3,4-tetrahydro-2-methylquinoline for precise and reliable results in advanced drug development and organic chemistry investigations.
Catalog Number | R013209 |
CAS Number | 42835-89-2 |
Synonyms | 1,2,3,4-Tetrahydro-6-fluoro-2-methylquinoline; 6-Fluoro-2-methyl-1,2,3,4-tetrahydroquinoline; |
Molecular Formula | C10H12FN |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 6-fluoro-2-methyl-1,2,3,4-tetrahydroquinoline |
InChI | InChI=1S/C10H12FN/c1-7-2-3-8-6-9(11)4-5-10(8)12-7/h4-7,12H,2-3H2,1H3 |
InChIKey | BDCCXYVTXRUGAN-UHFFFAOYSA-N |
SMILES | CC1CCC2=C(N1)C=CC(=C2)F |