For research use only. Not for therapeutic Use.
6-Fluoro-1H-benzo[d]imidazole-2-carbaldehyde(Cat No.:L048140)is a fluorinated heterocyclic compound featuring a benzoimidazole ring system, crucial for its biological activity. The presence of a fluoro group enhances the compound’s electronic characteristics and increases its metabolic stability, making it valuable in medicinal chemistry. The carbaldehyde group provides a versatile site for further chemical modifications, essential in synthesizing various pharmaceuticals. This compound is particularly important in the development of drugs targeting enzyme inhibition and receptor modulation, contributing to treatments for diseases that involve disrupted cellular signaling pathways.
CAS Number | 885280-34-2 |
Molecular Formula | C8H5FN2O |
Purity | ≥95% |
IUPAC Name | 6-fluoro-1H-benzimidazole-2-carbaldehyde |
InChI | InChI=1S/C8H5FN2O/c9-5-1-2-6-7(3-5)11-8(4-12)10-6/h1-4H,(H,10,11) |
InChIKey | XTQRRWMIWMTBDL-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=C1F)NC(=N2)C=O |