For research use only. Not for therapeutic Use.
6-Fluoro-3,4-dihydro-2H-isoquinolin-1-one(Cat No.:L031920)is a fluorinated isoquinolinone derivative, known for its structural and chemical versatility in medicinal chemistry. This compound features a partially saturated isoquinoline ring fused with a lactam, enhancing its potential as a bioactive scaffold. The fluorine atom at the 6-position significantly impacts the molecule’s pharmacokinetic properties, including increased metabolic stability and enhanced binding to biological targets. This makes it a valuable intermediate in the synthesis of neurological agents and analgesics. 6-Fluoro-3,4-dihydro-2H-isoquinolin-1-one is instrumental in developing new therapeutic drugs with improved efficacy and safety profiles.
CAS Number | 214045-84-8 |
Molecular Formula | C9H8FNO |
Purity | ≥95% |
IUPAC Name | 6-fluoro-3,4-dihydro-2H-isoquinolin-1-one |
InChI | InChI=1S/C9H8FNO/c10-7-1-2-8-6(5-7)3-4-11-9(8)12/h1-2,5H,3-4H2,(H,11,12) |
InChIKey | QAYARJVVFMRVQJ-UHFFFAOYSA-N |
SMILES | C1CNC(=O)C2=C1C=C(C=C2)F |