For research use only. Not for therapeutic Use.
6-Fluoro-7-nitroquinoxaline is a fluorinated nitroquinoxaline derivative, with a fluorine atom at the 6-position and a nitro group at the 7-position on the quinoxaline ring. This compound is valuable in pharmaceutical research, particularly in neurobiology, as it is used in synthesizing molecules that interact with neurotransmitter receptors. Its electron-withdrawing nitro and fluoro groups contribute to its reactivity, making it a suitable intermediate for complex molecule construction. It supports advanced research in drug discovery and development.
Catalog Number | L010530 |
CAS Number | 113269-08-2 |
Molecular Formula | C8H4FN3O2 |
Purity | ≥95% |
IUPAC Name | 6-fluoro-7-nitroquinoxaline |
InChI | InChI=1S/C8H4FN3O2/c9-5-3-6-7(11-2-1-10-6)4-8(5)12(13)14/h1-4H |
InChIKey | BMTBARLERYHLHR-UHFFFAOYSA-N |
SMILES | C1=CN=C2C=C(C(=CC2=N1)[N+](=O)[O-])F |