For research use only. Not for therapeutic Use.
6-Fluoronicotinic Acid Methyl Ester(CAT: M047629) is a fluorinated pyridine derivative featuring a methyl ester functionality. This compound is widely utilized in pharmaceutical and chemical research as a key intermediate for the synthesis of bioactive molecules, including potential drug candidates. Its fluorine substitution enhances lipophilicity and metabolic stability, making it valuable in medicinal chemistry applications. With high purity and structural versatility, 6-Fluoronicotinic Acid Methyl Ester is an essential building block for researchers developing advanced materials, enzyme inhibitors, or receptor modulators in innovative drug discovery and chemical synthesis projects.
CAS Number | 1427-06-1 |
Molecular Formula | C7H6FNO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | methyl 6-fluoropyridine-3-carboxylate |
InChI | InChI=1S/C7H6FNO2/c1-11-7(10)5-2-3-6(8)9-4-5/h2-4H,1H3 |
InChIKey | HLYBWNNPVXFCPZ-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CN=C(C=C1)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |