For research use only. Not for therapeutic Use.
6-Fluoroquinolin-2(1H)-one is an organic compound characterized by a quinoline structure with a fluorine atom at the sixth position and a keto group (C=O) at the second position. Its chemical formula is C₉H₆F₁N₁O. This compound is of interest in medicinal chemistry due to its potential biological activities, including antibacterial and antiviral properties. The presence of the fluorine atom enhances its lipophilicity and reactivity, making it a valuable scaffold for drug discovery and the development of novel therapeutic agents.
Catalog Number | L047610 |
CAS Number | 22614-75-1 |
Molecular Formula | C9H6FNO |
Purity | ≥95% |
IUPAC Name | 6-fluoro-1H-quinolin-2-one |
InChI | InChI=1S/C9H6FNO/c10-7-2-3-8-6(5-7)1-4-9(12)11-8/h1-5H,(H,11,12) |
InChIKey | CJVMYPHDEMEFEM-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=CC(=O)N2)C=C1F |