For research use only. Not for therapeutic Use.
6-Fluoroquinoline-4-carboxylic acid is an organic compound with the molecular formula C₉H₆FNO₂. It features a quinoline structure with a carboxylic acid group at the 4-position and a fluorine substituent at the 6-position. This compound appears as a solid and is of interest in medicinal chemistry due to its potential antibacterial and anticancer properties. Its unique structural features may enhance its biological activity, making it a valuable intermediate in synthesizing various pharmaceuticals and agrochemicals, as well as in drug discovery research.
CAS Number | 220844-73-5 |
Molecular Formula | C10H6FNO2 |
Purity | ≥95% |
IUPAC Name | 6-fluoroquinoline-4-carboxylic acid |
InChI | InChI=1S/C10H6FNO2/c11-6-1-2-9-8(5-6)7(10(13)14)3-4-12-9/h1-5H,(H,13,14) |
InChIKey | FNGWSJQERDIOJO-UHFFFAOYSA-N |
SMILES | C1=CC2=NC=CC(=C2C=C1F)C(=O)O |