For research use only. Not for therapeutic Use.
6-Hydroxy bentazon（Cat No.:R013572）, is a derivative of bentazon, an herbicide used in agriculture. This compound features a bentazon backbone with a hydroxyl group (-OH) attached. The addition of the hydroxyl group introduces a functional group that may influence the herbicidal activity or the chemical reactivity of the molecule. Understanding the effects of this modification can be relevant for agricultural applications, as it could impact the compound’s effectiveness and environmental fate.
| Catalog Number | R013572 |
| CAS Number | 60374-42-7 |
| Synonyms | 6-Hydroxy-3-(1-methylethyl)-1H-2,1,3-benzothiadiazin-4(3H)-one 2,2-Dioxide; ?6-Hydroxybentazone; |
| Molecular Formula | C10H12N2O4S |
| Purity | ≥95% |
| Target | Drug Metabolite |
| Storage | -20°C |
| IUPAC Name | 6-hydroxy-2,2-dioxo-3-propan-2-yl-1H-2$l^{6} |
| InChI | InChI=1S/C10H12N2O4S/c1-6(2)12-10(14)8-5-7(13)3-4-9(8)11-17(12,15)16/h3-6,11,13H,1-2H3 |
| InChIKey | PVKWIOBXPPFARA-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(=O)C2=C(C=CC(=C2)O)NS1(=O)=O |
| Reference | <p> |
