For research use only. Not for therapeutic Use.
6-Hydroxyindole(Cat No.:R072388)is an important heterocyclic compound featuring a hydroxyl group at the 6-position of the indole ring. It serves as a key intermediate in the synthesis of various bioactive molecules, including pharmaceuticals, agrochemicals, and natural products. Its hydroxyl group offers reactivity that can be exploited for further chemical modifications, making it a valuable building block in medicinal chemistry. 6-Hydroxyindole is particularly useful in the development of serotonin-related compounds and other indole-based drugs, playing a crucial role in drug discovery and organic synthesis.
CAS Number | 2380-86-1 |
Molecular Formula | C8H7NO |
Purity | ≥95% |
IUPAC Name | 1H-indol-6-ol |
InChI | InChI=1S/C8H7NO/c10-7-2-1-6-3-4-9-8(6)5-7/h1-5,9-10H |
InChIKey | XAWPKHNOFIWWNZ-UHFFFAOYSA-N |
SMILES | C1=CC(=CC2=C1C=CN2)O |