For research use only. Not for therapeutic Use.
6-Hydroxyluteolin(Cat No.:M074182) is a flavonoid compound belonging to the subclass of flavones. It is structurally similar to luteolin, with a hydroxyl group (-OH) attached at the sixth carbon of the flavone backbone. This compound is found in various plant sources, including vegetables, fruits, and medicinal herbs. 6-Hydroxyluteolin exhibits antioxidant, anti-inflammatory, and anticancer properties, contributing to its potential therapeutic applications in the prevention and treatment of various diseases.
CAS Number | 18003-33-3 |
Synonyms | 6-hydroxyluteolin |
Molecular Formula | C15H10O7 |
Purity | ≥95% |
Target | Aldose Reductase |
Storage | -20°C |
IUPAC Name | 2-(3,4-dihydroxyphenyl)-5,6,7-trihydroxychromen-4-one |
InChI | InChI=1S/C15H10O7/c16-7-2-1-6(3-8(7)17)11-4-9(18)13-12(22-11)5-10(19)14(20)15(13)21/h1-5,16-17,19-21H |
InChIKey | VYAKIUWQLHRZGK-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1C2=CC(=O)C3=C(O2)C=C(C(=C3O)O)O)O)O |