For research use only. Not for therapeutic Use.
6-Hydroxypyrimidine-4-carbaldehyde(Cat No.:R074609) is a chemical compound with the molecular formula C5H4N2O2. It is a pyrimidine derivative with a hydroxyl group (-OH) and an aldehyde group (-CHO) attached to the pyrimidine ring. This compound has various applications in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. It can serve as a versatile building block for the synthesis of more complex molecules due to its reactivity towards a variety of chemical reactions, including condensation, oxidation, and reduction reactions.
CAS Number | 98136-87-9 |
Synonyms | 6-Hydroxypyrimidine-4-carbaldehyde; |
Molecular Formula | C5H4N2O2 |
Purity | ≥95% |
IUPAC Name | 6-oxo-1H-pyrimidine-4-carbaldehyde |
InChI | InChI=1S/C5H4N2O2/c8-2-4-1-5(9)7-3-6-4/h1-3H,(H,6,7,9) |
InChIKey | NHCWPYTVOAKGHW-UHFFFAOYSA-N |
SMILES | C1=C(N=CNC1=O)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |