For research use only. Not for therapeutic Use.
6-Iodo-2,3-dihydro-1H-indole hydrochloride is an indole derivative characterized by an iodine atom and a dihydro structure. This compound is of interest in organic synthesis and medicinal chemistry due to its potential biological activities, including antimicrobial and anticancer properties. The indole core is known for its ability to interact with various biological targets, making it a valuable scaffold for drug development. Researchers explore its applications in synthesizing novel therapeutic agents and studying its mechanisms of action in various biological systems.
Catalog Number | M016719 |
CAS Number | 115666-46-1 |
Molecular Formula | C8H8IN |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 6-iodo-2,3-dihydro-1H-indole |
InChI | InChI=1S/C8H8IN/c9-7-2-1-6-3-4-10-8(6)5-7/h1-2,5,10H,3-4H2 |
InChIKey | KGCBZEKELZUOFI-UHFFFAOYSA-N |
SMILES | C1CNC2=C1C=CC(=C2)I |