For research use only. Not for therapeutic Use.
6-Iodoquinolin-4-amine is an aromatic compound featuring a quinoline ring substituted with an amino group at the 4-position and an iodine atom at the 6-position. This compound possesses interesting pharmacological properties and is studied for its potential as an antimicrobial and anticancer agent. The presence of iodine enhances its reactivity, making it a useful intermediate in organic synthesis. Its unique structure also lends itself to applications in the development of novel therapeutic agents and in medicinal chemistry research.
CAS Number | 40107-08-2 |
Molecular Formula | C9H7IN2 |
Purity | ≥95% |
IUPAC Name | 6-iodoquinolin-4-amine |
InChI | InChI=1S/C9H7IN2/c10-6-1-2-9-7(5-6)8(11)3-4-12-9/h1-5H,(H2,11,12) |
InChIKey | LFWKSYGYAIRXDM-UHFFFAOYSA-N |
SMILES | C1=CC2=NC=CC(=C2C=C1I)N |