For research use only. Not for therapeutic Use.
6-Iodoquinoline-2,4(1H,3H)-dione(CAT: L049079) is a high-purity heterocyclic compound featuring an iodo-substituted quinoline core with two carbonyl groups at positions 2 and 4. This unique structure makes it a valuable intermediate in pharmaceutical research, particularly for the synthesis of bioactive molecules, small-molecule inhibitors, and complex heterocycles. The iodine atom provides a handle for further functionalization via cross-coupling reactions, such as Suzuki-Miyaura or Sonogashira couplings, enabling the development of advanced derivatives. 6-Iodoquinoline-2,4(1H,3H)-dione is ideal for medicinal chemistry and fine chemical synthesis, offering chemical versatility, stability, and precision for both academic and industrial applications.
CAS Number | 658709-62-7 |
Molecular Formula | C9H6INO2 |
Purity | ≥95% |
IUPAC Name | 6-iodo-1H-quinoline-2,4-dione |
InChI | InChI=1S/C9H6INO2/c10-5-1-2-7-6(3-5)8(12)4-9(13)11-7/h1-3H,4H2,(H,11,13) |
InChIKey | BOUMFGOWEBRZCY-UHFFFAOYSA-N |
SMILES | C1C(=O)C2=C(C=CC(=C2)I)NC1=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |