For research use only. Not for therapeutic Use.
6-Isopropylisoquinoline (Cat.No:L003570) is a notable organic compound with diverse applications in medicinal chemistry. Its unique isoquinoline framework imparts distinctive pharmacological properties, rendering it valuable in drug development. This compound’s structural features make it a promising scaffold for the synthesis of novel pharmaceuticals, highlighting its significance in modern pharmaceutical research.
| Catalog Number | L003570 |
| CAS Number | 790304-84-6 |
| Molecular Formula | C12H13N |
| Purity | ≥95% |
| IUPAC Name | 6-propan-2-ylisoquinoline |
| InChI | InChI=1S/C12H13N/c1-9(2)10-3-4-12-8-13-6-5-11(12)7-10/h3-9H,1-2H3 |
| InChIKey | ILBIJOWSHVGZPU-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC2=C(C=C1)C=NC=C2 |
