For research use only. Not for therapeutic Use.
6-Isopropylpyridin-3-amine hydrochloride (Cat.No:L003848) is a significant chemical compound with versatile applications. Its unique structure, featuring an isopropyl group and a pyridine ring, imparts distinctive reactivity and properties. This compound serves as a crucial intermediate in the synthesis of specialized materials and pharmaceuticals. Its versatile nature makes it an essential component in the development of innovative products across industries, highlighting its importance in the field of chemical synthesis and materials science.
CAS Number | 1061875-23-7 |
Molecular Formula | C8H13ClN2 |
Purity | ≥95% |
IUPAC Name | 6-propan-2-ylpyridin-3-amine;hydrochloride |
InChI | InChI=1S/C8H12N2.ClH/c1-6(2)8-4-3-7(9)5-10-8;/h3-6H,9H2,1-2H3;1H |
InChIKey | CUMLEGOVSOWECA-UHFFFAOYSA-N |
SMILES | CC(C)C1=NC=C(C=C1)N.Cl |