For research use only. Not for therapeutic Use.
6-Maleimidocaproic acid(Cat No.:R000678) is an acid derivative commonly employed as a pharmaceutical intermediate in chemical synthesis. Its versatile nature allows it to be utilized in the production of various pharmaceutical compounds. Additionally, 6-Maleimidocaproic acid acts as a surfactant, enabling it to lower surface tension and enhance the solubility of hydrophobic substances in water. With its water-soluble and bifunctional ligand properties, it has applications in diverse fields such as drug development, materials science, and biochemical research.
CAS Number | 55750-53-3 |
Synonyms | 2,5-Dihydro-2,5-dioxo-1H-pyrrole-1-hexanoic Acid; 6-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)hexanoic Acid; 6-Maleimidohexanoic Acid; N-(5-Carboxy-n-pentyl)maleimide; N-(5-Carboxypentyl)maleimide; ε-Maleimidocaproic Acid; ε-Maleimidohexanoic Acid; EMCA |
Molecular Formula | C10H13NO4 |
Purity | ≥95% |
Target | PROTAC Linkers |
Storage | 2-8°C |
IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)hexanoic acid |
InChI | InChI=1S/C10H13NO4/c12-8-5-6-9(13)11(8)7-3-1-2-4-10(14)15/h5-6H,1-4,7H2,(H,14,15) |
InChIKey | WOJKKJKETHYEAC-UHFFFAOYSA-N |
SMILES | C1=CC(=O)N(C1=O)CCCCCC(=O)O |