For research use only. Not for therapeutic Use.
6-Methoxy-2H-chromene-3-carboxylic acid(Cat No.:L029356)is a chromene derivative featuring a methoxy group at the 6-position and a carboxylic acid group at the 3-position on the chromene ring. This compound is widely used in pharmaceutical and chemical research as a key intermediate in the synthesis of bioactive molecules, including potential therapeutic agents. Its unique structure allows for versatile chemical modifications, making it valuable in the development of complex organic compounds. 6-Methoxy-2H-chromene-3-carboxylic acid is essential for researchers focused on drug discovery and medicinal chemistry.
CAS Number | 57543-62-1 |
Molecular Formula | C11H10O4 |
Purity | ≥95% |
IUPAC Name | 6-methoxy-2H-chromene-3-carboxylic acid |
InChI | InChI=1S/C11H10O4/c1-14-9-2-3-10-7(5-9)4-8(6-15-10)11(12)13/h2-5H,6H2,1H3,(H,12,13) |
InChIKey | VOOCQPOSPBMQSK-UHFFFAOYSA-N |
SMILES | COC1=CC2=C(C=C1)OCC(=C2)C(=O)O |