For research use only. Not for therapeutic Use.
6-Methoxy-3-methyl-isoquinoline is a heterocyclic compound commonly used in pharmaceutical research and organic synthesis. Its structure features an isoquinoline core with methoxy and methyl groups, making it a valuable intermediate in the development of bioactive molecules. This compound is particularly useful in the synthesis of alkaloid derivatives and other therapeutic agents. Its reactivity allows for various chemical modifications, supporting the creation of drugs and biologically active compounds, contributing to advancements in medicinal chemistry and drug discovery.
CAS Number | 14446-31-2 |
Synonyms | 6-Methoxy-3-Methyl-Isoquinoline |
Molecular Formula | C11H11NO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 6-methoxy-3-methylisoquinoline |
InChI | InChI=1S/C11H11NO/c1-8-5-10-6-11(13-2)4-3-9(10)7-12-8/h3-7H,1-2H3 |
InChIKey | IRFSFYPWBSAISE-UHFFFAOYSA-N |
SMILES | CC1=NC=C2C=CC(=CC2=C1)OC |