For research use only. Not for therapeutic Use.
6-Methoxy-4-methyl-indan-1-one is an indanone derivative characterized by a methoxy group at the 6-position and a methyl group at the 4-position. This compound is significant in organic synthesis and medicinal chemistry, serving as an intermediate for developing various bioactive molecules. The methoxy group enhances solubility and reactivity, while the carbonyl group contributes to its electrophilic properties. Its unique structure allows for diverse functionalizations, making it valuable in the synthesis of pharmaceuticals and exploring new therapeutic agents.
CAS Number | 89837-18-3 |
Molecular Formula | C11H12O2 |
Purity | ≥95% |
IUPAC Name | 6-methoxy-4-methyl-2,3-dihydroinden-1-one |
InChI | InChI=1S/C11H12O2/c1-7-5-8(13-2)6-10-9(7)3-4-11(10)12/h5-6H,3-4H2,1-2H3 |
InChIKey | YKKMPRDPHSDNOG-UHFFFAOYSA-N |
SMILES | CC1=CC(=CC2=C1CCC2=O)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |