For research use only. Not for therapeutic Use.
6-Methoxy Isoquinoline is a heterocyclic aromatic compound featuring an isoquinoline core with a methoxy group attached at the 6-position. It is commonly used as a building block in the synthesis of various biologically active molecules, particularly in medicinal chemistry and pharmaceutical research. The methoxy group enhances the compound’s electronic properties, making it suitable for reactions that explore drug-like activity. 6-Methoxy Isoquinoline has potential applications in developing therapeutic agents for cardiovascular and neurological diseases, as well as in the synthesis of natural product analogs and alkaloid derivatives. Its structural versatility makes it a valuable tool in chemical research.
CAS Number | 52986-70-6 |
Molecular Formula | C10H9NO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 6-methoxyisoquinoline |
InChI | InChI=1S/C10H9NO/c1-12-10-3-2-9-7-11-5-4-8(9)6-10/h2-7H,1H3 |
InChIKey | XZNUJESLPUNSNO-UHFFFAOYSA-N |
SMILES | COC1=CC2=C(C=C1)C=NC=C2 |