For research use only. Not for therapeutic Use.
6-Methoxychromone(CAT: L048795) is a high-purity heterocyclic compound widely used in pharmaceutical, biochemical, and chemical research. Featuring a chromone core with a methoxy group at the 6-position, this compound exhibits unique structural and electronic properties, making it a valuable intermediate in the synthesis of bioactive molecules and natural product derivatives. Its versatility supports applications in medicinal chemistry, particularly in the development of therapeutic agents with antioxidant, anti-inflammatory, or antimicrobial properties. 6-Methoxychromone ensures reliable performance and consistency, facilitating innovative research in drug discovery and advanced chemical synthesis.A
CAS Number | 59887-88-6 |
Molecular Formula | C10H8O3 |
Purity | ≥95% |
IUPAC Name | 6-methoxychromen-4-one |
InChI | InChI=1S/C10H8O3/c1-12-7-2-3-10-8(6-7)9(11)4-5-13-10/h2-6H,1H3 |
InChIKey | PGFLLSYSGYEGHZ-UHFFFAOYSA-N |
SMILES | COC1=CC2=C(C=C1)OC=CC2=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |