For research use only. Not for therapeutic Use.
6-Methoxyisoquinoline-4-carboxylic acid(CAT: L000293) is a compound of significance in pharmaceutical and organic chemistry. This chemical serves as a key intermediate in the synthesis of pharmaceutical compounds. Its action method involves acting as a crucial building block in the development of drug candidates, particularly in the context of drug discovery and development.
Catalog Number | L000293 |
CAS Number | 1541071-15-1 |
Molecular Formula | C11H9NO3 |
Purity | ≥95% |
IUPAC Name | 6-methoxyisoquinoline-4-carboxylic acid |
InChI | InChI=1S/C11H9NO3/c1-15-8-3-2-7-5-12-6-10(11(13)14)9(7)4-8/h2-6H,1H3,(H,13,14) |
InChIKey | DCMWWVQGWYKJQS-UHFFFAOYSA-N |