For research use only. Not for therapeutic Use.
6-Methoxykaempferol（Cat No.:I042271）is a flavonoid compound found in several plants, recognized for its potential health benefits. It is a methoxy derivative of kaempferol, a common flavonoid known for its antioxidant, anti-inflammatory, and anticancer properties. Research suggests that 6-methoxykaempferol may help protect cells from oxidative stress, reduce inflammation, and inhibit the growth of cancer cells. Its bioactive properties make it a promising candidate for therapeutic use in managing diseases related to inflammation, cardiovascular health, and cancer. Further studies are ongoing to explore its full range of effects and potential medical applications.
| Catalog Number | I042271 |
| CAS Number | 32520-55-1 |
| Synonyms | 3,5,7-trihydroxy-2-(4-hydroxyphenyl)-6-methoxychromen-4-one |
| Molecular Formula | C16H12O7 |
| Purity | ≥95% |
| IUPAC Name | 3,5,7-trihydroxy-2-(4-hydroxyphenyl)-6-methoxychromen-4-one |
| InChI | InChI=1S/C16H12O7/c1-22-16-9(18)6-10-11(13(16)20)12(19)14(21)15(23-10)7-2-4-8(17)5-3-7/h2-6,17-18,20-21H,1H3 |
| InChIKey | OGQSUSFDBWGFFJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1O)OC(=C(C2=O)O)C3=CC=C(C=C3)O)O |
