Home
>
Chemical Reagents>Heterocyclic Building Blocks> 6-Methyl-2-azaspiro[3.3]heptane hydrochloride
For research use only. Not for therapeutic Use.
6-Methyl-2-azaspiro[3.3]heptane hydrochloride is a bicyclic organic compound featuring a spirocyclic structure with a nitrogen atom, characterized by a methyl group at the sixth position. Its hydrochloride form is a salt that enhances its solubility in water. This compound is of interest in medicinal chemistry for its potential pharmacological properties, including effects on the central nervous system. The unique spirocyclic framework offers opportunities for diverse synthetic modifications, making it a valuable scaffold for drug discovery and development.
CAS Number | 2089649-42-1 |
Molecular Formula | C7H14ClN |
Purity | ≥95% |
IUPAC Name | 6-methyl-2-azaspiro[3.3]heptane;hydrochloride |
InChI | InChI=1S/C7H13N.ClH/c1-6-2-7(3-6)4-8-5-7;/h6,8H,2-5H2,1H3;1H |
InChIKey | DLLVYOKIJGFCAY-UHFFFAOYSA-N |
SMILES | CC1CC2(C1)CNC2.Cl |