For research use only, not for therapeutic use.
6-Methyl-2,6-diazaspiro[3.4]octane(Cat No.:L006707), is a chemical compound characterized by a spirocyclic structure, consisting of a diazaspirooctane ring with a methyl substituent at the 6th position. This compound has potential applications in organic synthesis and medicinal chemistry. Spirocyclic compounds often exhibit unique biological activities, making them valuable in drug discovery research. The specific arrangement of atoms in 6-Methyl-2,6-diazaspiro[3.4]octane provides opportunities for diverse chemical transformations, contributing to the creation of novel molecules.
Catalog Number | L006707 |
CAS Number | 135380-24-4 |
Molecular Formula | C7H14N2 |
Purity | ≥95% |
IUPAC Name | 6-methyl-2,6-diazaspiro[3.4]octane |
InChI | InChI=1S/C7H14N2/c1-9-3-2-7(6-9)4-8-5-7/h8H,2-6H2,1H3 |
InChIKey | ZDUBHABFLXJXFM-UHFFFAOYSA-N |
SMILES | CN1CCC2(C1)CNC2 |