For research use only. Not for therapeutic Use.
6-Methyl-5-nitropyridine-2,4-diol is a nitrogen-containing heterocyclic compound with a methyl and nitro group on a pyridine ring and two hydroxyl groups. This compound is useful in pharmaceutical and biochemical research due to its potential bioactivity and versatility as a synthetic intermediate. Its structure, featuring electron-donating and electron-withdrawing groups, enhances reactivity, making it valuable for developing bioactive molecules, especially in studies focused on enzyme inhibition and antioxidant activity. Its stability supports a variety of applications in medicinal chemistry and drug design.
CAS Number | 344749-44-6 |
Molecular Formula | C6H6N2O4 |
Purity | ≥95% |
IUPAC Name | 4-hydroxy-6-methyl-5-nitro-1H-pyridin-2-one |
InChI | InChI=1S/C6H6N2O4/c1-3-6(8(11)12)4(9)2-5(10)7-3/h2H,1H3,(H2,7,9,10) |
InChIKey | CIUJVYFTEYYUBS-UHFFFAOYSA-N |
SMILES | CC1=C(C(=CC(=O)N1)O)[N+](=O)[O-] |