For research use only. Not for therapeutic Use.
6-Methyl-5,6-dihydro-2H-pyran-2-one(CAT: M069970), also known as δ-decalactone, is a lactone compound characterized by a sweet, creamy, and fruity aroma, often reminiscent of peaches or coconut. This compound is widely used in the flavor and fragrance industries due to its pleasant scent and flavor profile. It is commonly found in natural sources such as fruits and dairy products, but can also be synthetically produced. In addition to its use in food flavoring and perfumes, 6-Methyl-5,6-dihydro-2H-pyran-2-one is studied in organic chemistry for its role as a building block in the synthesis of more complex molecules, particularly in the realm of pharmaceuticals and natural product chemistry.
CAS Number | 108-54-3 |
Synonyms | 2-methyl-2,3-dihydropyran-6-one |
Molecular Formula | C6H8O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-methyl-2,3-dihydropyran-6-one |
InChI | InChI=1S/C6H8O2/c1-5-3-2-4-6(7)8-5/h2,4-5H,3H2,1H3 |
InChIKey | DYNKRGCMLGUEMN-UHFFFAOYSA-N |
SMILES | CC1CC=CC(=O)O1 |