Home
>
Chemical Reagents>Heterocyclic Building Blocks> 6-Methyl-5,6,7,8-tetrahydro-pyrido[4,3-d]pyrimidin-2-ylamine
For research use only. Not for therapeutic Use.
6-Methyl-5,6,7,8-tetrahydro-pyrido[4,3-d]pyrimidin-2-ylamine(Cat No.:L011346)is a key compound in pharmaceutical research, particularly in the synthesis of heterocyclic compounds with potential therapeutic properties. This pyridopyrimidine derivative is often utilized as a building block in the development of kinase inhibitors and other bioactive molecules. Its unique structure, featuring a methylated tetrahydropyridopyrimidine core, allows for versatile chemical modifications, making it valuable in drug discovery and medicinal chemistry. With high purity and consistent quality, it supports precise and efficient research, enabling the exploration of new therapeutic agents.
CAS Number | 66521-82-2 |
Molecular Formula | C8H12N4 |
Purity | ≥95% |
IUPAC Name | 6-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-amine |
InChI | InChI=1S/C8H12N4/c1-12-3-2-7-6(5-12)4-10-8(9)11-7/h4H,2-3,5H2,1H3,(H2,9,10,11) |
InChIKey | PIPQOCFCFJJFNQ-UHFFFAOYSA-N |
SMILES | CN1CCC2=NC(=NC=C2C1)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |