For research use only. Not for therapeutic Use.
N It is less common in higher eukaryotes and extremely rare in mammals. Like methylation of other DNA residues, N<sup>6</sup>-methyladenine represents an epigenetic modification that can affect diverse DNA functions, including replication, repair, and expression.
CAS Number | 443-72-1 |
Synonyms | 6-(Methylamino)purine; 6-(N-Methylamino)purine; 6-MAP; 6-Methyladenine; 6-Mono(methylamino)purine; 6-N-Methyladenine; N-Methyl-6-aminopurine; N-Methyl-9H-purin-6-amine; N6-Methyladenine; N6-Methylaminopurine; N6-Monomethyladenine; NSC 11580 |
Molecular Formula | C6H7N5 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | N-methyl-7H-purin-6-amine |
InChI | InChI=1S/C6H7N5/c1-7-5-4-6(10-2-8-4)11-3-9-5/h2-3H,1H3,(H2,7,8,9,10,11) |
InChIKey | CKOMXBHMKXXTNW-UHFFFAOYSA-N |
SMILES | CNC1=NC=NC2=C1NC=N2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |