For research use only. Not for therapeutic Use.
6-(Methylamino)nicotinonitrile is a nitrile compound featuring a methylamino group at the 6-position of a nicotinonitrile core. This compound is of interest in organic synthesis and pharmaceutical research, particularly in developing compounds with potential biological activity. The methylamino group enhances the compound’s reactivity and provides opportunities for further modifications. Its nitrile functional group may contribute to its properties in coordination chemistry and medicinal applications, making it valuable for exploring new therapeutic agents and conducting chemical research.
| Catalog Number | L041795 |
| CAS Number | 261715-36-0 |
| Molecular Formula | C7H7N3 |
| Purity | ≥95% |
| IUPAC Name | 6-(methylamino)pyridine-3-carbonitrile |
| InChI | InChI=1S/C7H7N3/c1-9-7-3-2-6(4-8)5-10-7/h2-3,5H,1H3,(H,9,10) |
| InChIKey | OFCRHTLXDCWARW-UHFFFAOYSA-N |
| SMILES | CNC1=NC=C(C=C1)C#N |
