For research use only. Not for therapeutic Use.
6-Methylbenzo[d][1,3]dioxol-5-amine(CAT: L039572) is a heterocyclic organic compound featuring a benzodioxole core with a methyl group at the 6-position and an amine group at the 5-position. This compound serves as a key intermediate in the synthesis of various bioactive molecules and pharmaceuticals. Its structural motif, incorporating both oxygen-containing dioxole and amine functionalities, makes it useful for medicinal chemistry, particularly in the design of compounds with potential therapeutic applications, such as antimicrobial, anticancer, and anti-inflammatory agents. The presence of both electron-donating and electron-withdrawing groups allows for further functionalization and modification in drug development.
CAS Number | 62052-49-7 |
Molecular Formula | C8H9NO2 |
Purity | ≥95% |
IUPAC Name | 6-methyl-1,3-benzodioxol-5-amine |
InChI | InChI=1S/C8H9NO2/c1-5-2-7-8(3-6(5)9)11-4-10-7/h2-3H,4,9H2,1H3 |
InChIKey | PFLGEPXBHVTBNJ-UHFFFAOYSA-N |