For research use only. Not for therapeutic Use.
6-Methylnicotinamide is a derivative of nicotinamide, featuring a methyl group at the 6-position of the pyridine ring. It is commonly used in pharmaceutical research, particularly in studies involving NAD+ metabolism and cellular energy pathways. As a structural analog of nicotinamide, it plays a role in understanding enzyme interactions, redox biology, and cell signaling processes. 6-Methylnicotinamide is also explored for its potential therapeutic applications, including anti-inflammatory and antioxidant effects, contributing to advancements in medicinal chemistry and metabolic research.
CAS Number | 6960-22-1 |
Synonyms | 6-Methyl-3-Pyridinecarboxamide; 6-Methylnicotinic Acid Amide; 6-Methylpyridine-3-carboxamide; |
Molecular Formula | C7H8N2O |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -20°C |
IUPAC Name | 6-methylpyridine-3-carboxamide |
InChI | InChI=1S/C7H8N2O/c1-5-2-3-6(4-9-5)7(8)10/h2-4H,1H3,(H2,8,10) |
InChIKey | IJXDURUAYOKSIS-UHFFFAOYSA-N |
SMILES | CC1=NC=C(C=C1)C(=O)N |