Home
>
Chemical Reagents>Heterocyclic Building Blocks> (6-Methylpyridin-2-Yl)Methanamine Hydrochloride
For research use only. Not for therapeutic Use.
(6-Methylpyridin-2-yl)methanamine hydrochloride(CAT: L035165) is a pyridine derivative commonly used as an intermediate in pharmaceutical synthesis. The molecule consists of a 6-methyl-substituted pyridine ring with a methanamine group attached at the 2-position, forming a primary amine that is further stabilized as a hydrochloride salt. The hydrochloride form enhances its solubility and stability, making it easier to handle in aqueous or polar organic solvents. This compound is valuable in medicinal chemistry for building more complex molecules, particularly for developing bioactive agents targeting neurological and metabolic pathways. Its structure allows for further functionalization, enabling the synthesis of a range of therapeutic candidates.
CAS Number | 1365836-53-8 |
Molecular Formula | C7H11ClN2 |
Purity | ≥95% |
IUPAC Name | (6-methylpyridin-2-yl)methanamine;hydrochloride |
InChI | InChI=1S/C7H10N2.ClH/c1-6-3-2-4-7(5-8)9-6;/h2-4H,5,8H2,1H3;1H |
InChIKey | AKRHDUMLUMKGNA-UHFFFAOYSA-N |