For research use only. Not for therapeutic Use.
6-Methylthioguanine is a thiopurine derivative of guanine, characterized by a methylthio group at the 6-position. This compound is of interest in medicinal chemistry and biochemistry due to its potential antitumor properties, particularly in the treatment of certain leukemias and lymphomas. As a nucleobase analogue, it can interfere with DNA replication and repair processes, leading to cytotoxic effects in rapidly dividing cancer cells. Researchers explore its mechanisms of action and potential applications in cancer therapy, contributing to the development of targeted treatments.
| Catalog Number | R053443 |
| CAS Number | 1198-47-6 |
| Synonyms | 6-(Methylthio)-1H-purin-2-amine; 2-Amino-6-methylmercaptopurine; NSC 29420; 2-Amino-6-methylthiopurine; S-Methyl-6-thioguanine; S6-Methyl-6-thioguanine; |
| Molecular Formula | C6H7N5S |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 6-methylsulfanyl-7H-purin-2-amine |
| InChI | InChI=1S/C6H7N5S/c1-12-5-3-4(9-2-8-3)10-6(7)11-5/h2H,1H3,(H3,7,8,9,10,11) |
| InChIKey | YEGKYFQLKYGHAR-UHFFFAOYSA-N |
| SMILES | CSC1=NC(=NC2=C1NC=N2)N |
